C14H32N3O3P — CID 15297442
1-(diethoxyphosphorylmethyl)-1,5,9-triazacyclododecane (PubChem CID 15297442) has the molecular formula C14H32N3O3P and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-(diethoxyphosphorylmethyl)-1,5,9-triazacyclododecane.
| Compound Name | 1-(diethoxyphosphorylmethyl)-1,5,9-triazacyclododecane |
|---|---|
| PubChem CID | 15297442 |
| Molecular Formula | C14H32N3O3P |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 1-(diethoxyphosphorylmethyl)-1,5,9-triazacyclododecane |
| SMILES | CCOP(=O)(CN1CCCNCCCNCCC1)OCC |
| InChI | InChI=1S/C14H32N3O3P/c1-3-19-21(18,20-4-2)14-17-12-6-10-15-8-5-9-16-11-7-13-17/h15-16H,3-14H2,1-2H3 |
| InChIKey | RVUSERSKGBFCFO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|