C12H29N4O4P2+ — CID 177405859
hydroxy-[[hydroxy(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)phosphoryl]methyl]-oxophosphanium (PubChem CID 177405859) has the molecular formula C12H29N4O4P2+ and a molecular weight of 355.34 g/mol. Its IUPAC name is hydroxy-[[hydroxy(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)phosphoryl]methyl]-oxophosphanium.
| Compound Name | hydroxy-[[hydroxy(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)phosphoryl]methyl]-oxophosphanium |
|---|---|
| PubChem CID | 177405859 |
| Molecular Formula | C12H29N4O4P2+ |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | hydroxy-[[hydroxy(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)phosphoryl]methyl]-oxophosphanium |
| SMILES | O=[P+](O)CP(=O)(O)CN1CCCNCCNCCCNCC1 |
| InChI | InChI=1S/C12H28N4O4P2/c17-21(18)12-22(19,20)11-16-9-2-5-14-7-6-13-3-1-4-15-8-10-16/h13-15H,1-12H2,(H-,17,18,19,20)/p+1 |
| InChIKey | ZLUGLPCSHBDTTN-UHFFFAOYSA-O |
| XLogP | -0.23 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|