C29H58N8 — CID 138462145
1-[(2E,3Z)-2-ethylidene-5-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)hexa-3,5-dienyl]-1,4,8,11-tetrazacyclotetradecane (PubChem CID 138462145) has the molecular formula C29H58N8 and a molecular weight of 518.84 g/mol. Its IUPAC name is 1-[(2E,3Z)-2-ethylidene-5-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)hexa-3,5-dienyl]-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | 1-[(2E,3Z)-2-ethylidene-5-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)hexa-3,5-dienyl]-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 138462145 |
| Molecular Formula | C29H58N8 |
| Molecular Weight | 518.84 g/mol |
| Exact Mass | 518.48 |
| IUPAC Name | 1-[(2E,3Z)-2-ethylidene-5-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)hexa-3,5-dienyl]-1,4,8,11-tetrazacyclotetradecane |
| SMILES | C=C(/C=C\C(=C/C)CN1CCCNCCNCCCNCC1)CN1CCCNCCNCCCNCC1 |
| InChI | InChI=1S/C29H58N8/c1-3-29(27-37-23-7-15-33-19-17-31-11-5-13-35-21-25-37)9-8-28(2)26-36-22-6-14-32-18-16-30-10-4-12-34-20-24-36/h3,8-9,30-35H,2,4-7,10-27H2,1H3/b9-8-,29-3+ |
| InChIKey | XSICGZRKTKSTHR-VBAKEHBLSA-N |
| XLogP | 0.77 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.84 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|