C31H58N8 — CID 143152119
5-[(2E,4E)-2-methyl-5-(1,4,7,10-tetrazabicyclo[8.2.2]tetradecan-4-ylmethyl)hepta-2,4,6-trienyl]-1,5,8,12-tetrazabicyclo[10.2.2]hexadecane (PubChem CID 143152119) has the molecular formula C31H58N8 and a molecular weight of 542.86 g/mol. Its IUPAC name is 5-[(2E,4E)-2-methyl-5-(1,4,7,10-tetrazabicyclo[8.2.2]tetradecan-4-ylmethyl)hepta-2,4,6-trienyl]-1,5,8,12-tetrazabicyclo[10.2.2]hexadecane.
| Compound Name | 5-[(2E,4E)-2-methyl-5-(1,4,7,10-tetrazabicyclo[8.2.2]tetradecan-4-ylmethyl)hepta-2,4,6-trienyl]-1,5,8,12-tetrazabicyclo[10.2.2]hexadecane |
|---|---|
| PubChem CID | 143152119 |
| Molecular Formula | C31H58N8 |
| Molecular Weight | 542.86 g/mol |
| Exact Mass | 542.48 |
| IUPAC Name | 5-[(2E,4E)-2-methyl-5-(1,4,7,10-tetrazabicyclo[8.2.2]tetradecan-4-ylmethyl)hepta-2,4,6-trienyl]-1,5,8,12-tetrazabicyclo[10.2.2]hexadecane |
| SMILES | C=C/C(=C\C=C(/C)CN1CCCN2CCN(CCCNCC1)CC2)CN1CCNCCN2CCN(CC2)CC1 |
| InChI | InChI=1S/C31H58N8/c1-3-31(29-39-17-11-33-9-15-36-22-24-37(25-23-36)26-27-39)7-6-30(2)28-38-14-5-13-35-20-18-34(19-21-35)12-4-8-32-10-16-38/h3,6-7,32-33H,1,4-5,8-29H2,2H3/b30-6+,31-7+ |
| InChIKey | COUYZUDKRVVOEB-HBVASZCPSA-N |
| XLogP | 0.87 |
| TPSA | 43.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.86 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|