C12H17NO — CID 134173341
(3Z)-2-methylidene-5-(pyrrolidin-1-ylmethyl)hexa-3,5-dienal (PubChem CID 134173341) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (3Z)-2-methylidene-5-(pyrrolidin-1-ylmethyl)hexa-3,5-dienal.
| Compound Name | (3Z)-2-methylidene-5-(pyrrolidin-1-ylmethyl)hexa-3,5-dienal |
|---|---|
| PubChem CID | 134173341 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (3Z)-2-methylidene-5-(pyrrolidin-1-ylmethyl)hexa-3,5-dienal |
| SMILES | C=C(C=O)/C=C\C(=C)CN1CCCC1 |
| InChI | InChI=1S/C12H17NO/c1-11(5-6-12(2)10-14)9-13-7-3-4-8-13/h5-6,10H,1-4,7-9H2/b6-5- |
| InChIKey | FJIHASJJGIHNPB-WAYWQWQTSA-N |
| XLogP | 1.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|