About 4-(diethoxyphosphorylmethyl)-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine
4-(diethoxyphosphorylmethyl)-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine (PubChem CID 3815808) has the molecular formula C15H25N2O3P
and a molecular weight of 312.35 g/mol. Its IUPAC name is 4-(diethoxyphosphorylmethyl)-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine.
Molecular Properties
| Compound Name | 4-(diethoxyphosphorylmethyl)-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine |
| PubChem CID | 3815808 |
| Molecular Formula | C15H25N2O3P |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 4-(diethoxyphosphorylmethyl)-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine |
| SMILES | CCOP(=O)(CN1CCN(C)c2ccccc2C1)OCC |
| InChI | InChI=1S/C15H25N2O3P/c1-4-19-21(18,20-5-2)13-17-11-10-16(3)15-9-7-6-8-14(15)12-17/h6-9H,4-5,10-13H2,1-3H3 |
| InChIKey | DPVDFFIPSQLXNE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-(diethoxyphosphorylmethyl)-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethoxyphosphorylmethyl)-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine?
The IUPAC name of 4-(diethoxyphosphorylmethyl)-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine (CID 3815808) is 4-(diethoxyphosphorylmethyl)-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine.
What is the SMILES notation for 4-(diethoxyphosphorylmethyl)-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine?
The canonical SMILES for 4-(diethoxyphosphorylmethyl)-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine is CCOP(=O)(CN1CCN(C)c2ccccc2C1)OCC.
What is the InChIKey of 4-(diethoxyphosphorylmethyl)-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine?
The InChIKey is DPVDFFIPSQLXNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N2O3P/c1-4-19-21(18,20-5-2)13-17-11-10-16(3)15-9-7-6-8-14(15)12-17/h6-9H,4-5,10-13H2,1-3H3.
What are the key properties of 4-(diethoxyphosphorylmethyl)-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine?
4-(diethoxyphosphorylmethyl)-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine has a molecular weight of 312.35 g/mol, XLogP of 3.16, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethoxyphosphorylmethyl)-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine is sourced from PubChem (CID 3815808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).