C15H25N2O3P — CID 3815808
4-(diethoxyphosphorylmethyl)-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine (PubChem CID 3815808) has the molecular formula C15H25N2O3P and a molecular weight of 312.35 g/mol. Its IUPAC name is 4-(diethoxyphosphorylmethyl)-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine.
| Compound Name | 4-(diethoxyphosphorylmethyl)-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 3815808 |
| Molecular Formula | C15H25N2O3P |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 4-(diethoxyphosphorylmethyl)-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine |
| SMILES | CCOP(=O)(CN1CCN(C)c2ccccc2C1)OCC |
| InChI | InChI=1S/C15H25N2O3P/c1-4-19-21(18,20-5-2)13-17-11-10-16(3)15-9-7-6-8-14(15)12-17/h6-9H,4-5,10-13H2,1-3H3 |
| InChIKey | DPVDFFIPSQLXNE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|