C18H42N4O6P2 — CID 14938693
1,7-bis(diethoxyphosphorylmethyl)-1,4,7,10-tetrazacyclododecane (PubChem CID 14938693) has the molecular formula C18H42N4O6P2 and a molecular weight of 472.50 g/mol. Its IUPAC name is 1,7-bis(diethoxyphosphorylmethyl)-1,4,7,10-tetrazacyclododecane.
| Compound Name | 1,7-bis(diethoxyphosphorylmethyl)-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 14938693 |
| Molecular Formula | C18H42N4O6P2 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 1,7-bis(diethoxyphosphorylmethyl)-1,4,7,10-tetrazacyclododecane |
| SMILES | CCOP(=O)(CN1CCNCCN(CP(=O)(OCC)OCC)CCNCC1)OCC |
| InChI | InChI=1S/C18H42N4O6P2/c1-5-25-29(23,26-6-2)17-21-13-9-19-11-15-22(16-12-20-10-14-21)18-30(24,27-7-3)28-8-4/h19-20H,5-18H2,1-4H3 |
| InChIKey | CXIDSZOKIVMRPN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|