C15H29N4O5P — CID 87762157
butan-2-yloxy-[(11,12-dioxo-1,4,7,10-tetrazabicyclo[8.2.2]tetradecan-4-yl)methyl]phosphinic acid (PubChem CID 87762157) has the molecular formula C15H29N4O5P and a molecular weight of 376.39 g/mol. Its IUPAC name is butan-2-yloxy-[(11,12-dioxo-1,4,7,10-tetrazabicyclo[8.2.2]tetradecan-4-yl)methyl]phosphinic acid.
| Compound Name | butan-2-yloxy-[(11,12-dioxo-1,4,7,10-tetrazabicyclo[8.2.2]tetradecan-4-yl)methyl]phosphinic acid |
|---|---|
| PubChem CID | 87762157 |
| Molecular Formula | C15H29N4O5P |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | butan-2-yloxy-[(11,12-dioxo-1,4,7,10-tetrazabicyclo[8.2.2]tetradecan-4-yl)methyl]phosphinic acid |
| SMILES | CCC(C)OP(=O)(O)CN1CCNCCN2CCN(CC1)C(=O)C2=O |
| InChI | InChI=1S/C15H29N4O5P/c1-3-13(2)24-25(22,23)12-17-6-4-16-5-7-18-10-11-19(9-8-17)15(21)14(18)20/h13,16H,3-12H2,1-2H3,(H,22,23) |
| InChIKey | GDXUMGIEDNXRHP-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|