C13H26N4O3 — CID 54331887
propanoic acid;1,4,7,10-tetrazabicyclo[8.2.2]tetradecan-11-one (PubChem CID 54331887) has the molecular formula C13H26N4O3 and a molecular weight of 286.38 g/mol. Its IUPAC name is propanoic acid;1,4,7,10-tetrazabicyclo[8.2.2]tetradecan-11-one.
| Compound Name | propanoic acid;1,4,7,10-tetrazabicyclo[8.2.2]tetradecan-11-one |
|---|---|
| PubChem CID | 54331887 |
| Molecular Formula | C13H26N4O3 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | propanoic acid;1,4,7,10-tetrazabicyclo[8.2.2]tetradecan-11-one |
| SMILES | CCC(=O)O.O=C1CN2CCNCCNCCN1CC2 |
| InChI | InChI=1S/C10H20N4O.C3H6O2/c15-10-9-13-5-3-11-1-2-12-4-6-14(10)8-7-13;1-2-3(4)5/h11-12H,1-9H2;2H2,1H3,(H,4,5) |
| InChIKey | SYXJNCFGYGJJCU-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |