C26H44N4O4 — CID 67640955
5-(4-decyl-1,4,7,10-tetrazacyclododec-1-yl)benzene-1,3-dicarboxylic acid (PubChem CID 67640955) has the molecular formula C26H44N4O4 and a molecular weight of 476.66 g/mol. Its IUPAC name is 5-(4-decyl-1,4,7,10-tetrazacyclododec-1-yl)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(4-decyl-1,4,7,10-tetrazacyclododec-1-yl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 67640955 |
| Molecular Formula | C26H44N4O4 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.34 |
| IUPAC Name | 5-(4-decyl-1,4,7,10-tetrazacyclododec-1-yl)benzene-1,3-dicarboxylic acid |
| SMILES | CCCCCCCCCCN1CCNCCNCCN(c2cc(C(=O)O)cc(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C26H44N4O4/c1-2-3-4-5-6-7-8-9-14-29-15-12-27-10-11-28-13-16-30(18-17-29)24-20-22(25(31)32)19-23(21-24)26(33)34/h19-21,27-28H,2-18H2,1H3,(H,31,32)(H,33,34) |
| InChIKey | VYBRMHQLBNOWGJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|