C22H35N5 — CID 174992045
4-(1,4-diazepan-1-yl)-2-[(4-pentylpiperazin-1-yl)methyl]benzonitrile (PubChem CID 174992045) has the molecular formula C22H35N5 and a molecular weight of 369.56 g/mol. Its IUPAC name is 4-(1,4-diazepan-1-yl)-2-[(4-pentylpiperazin-1-yl)methyl]benzonitrile.
| Compound Name | 4-(1,4-diazepan-1-yl)-2-[(4-pentylpiperazin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 174992045 |
| Molecular Formula | C22H35N5 |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.29 |
| IUPAC Name | 4-(1,4-diazepan-1-yl)-2-[(4-pentylpiperazin-1-yl)methyl]benzonitrile |
| SMILES | CCCCCN1CCN(Cc2cc(N3CCCNCC3)ccc2C#N)CC1 |
| InChI | InChI=1S/C22H35N5/c1-2-3-4-10-25-13-15-26(16-14-25)19-21-17-22(7-6-20(21)18-23)27-11-5-8-24-9-12-27/h6-7,17,24H,2-5,8-16,19H2,1H3 |
| InChIKey | BLQVPTWDJWLYJP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 45.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|