C20H34N6 — CID 151755909
4-[bis[2-(dimethylamino)ethyl]amino]-2-(piperazin-1-ylmethyl)benzonitrile (PubChem CID 151755909) has the molecular formula C20H34N6 and a molecular weight of 358.53 g/mol. Its IUPAC name is 4-[bis[2-(dimethylamino)ethyl]amino]-2-(piperazin-1-ylmethyl)benzonitrile.
| Compound Name | 4-[bis[2-(dimethylamino)ethyl]amino]-2-(piperazin-1-ylmethyl)benzonitrile |
|---|---|
| PubChem CID | 151755909 |
| Molecular Formula | C20H34N6 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.28 |
| IUPAC Name | 4-[bis[2-(dimethylamino)ethyl]amino]-2-(piperazin-1-ylmethyl)benzonitrile |
| SMILES | CN(C)CCN(CCN(C)C)c1ccc(C#N)c(CN2CCNCC2)c1 |
| InChI | InChI=1S/C20H34N6/c1-23(2)11-13-26(14-12-24(3)4)20-6-5-18(16-21)19(15-20)17-25-9-7-22-8-10-25/h5-6,15,22H,7-14,17H2,1-4H3 |
| InChIKey | RPNKAWDXNLUNJB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |