C24H33N5 — CID 135144468
4-[1-amino-3-(dimethylamino)propyl]-2-[[4-(4-methylphenyl)piperazin-1-yl]methyl]benzonitrile (PubChem CID 135144468) has the molecular formula C24H33N5 and a molecular weight of 391.56 g/mol. Its IUPAC name is 4-[1-amino-3-(dimethylamino)propyl]-2-[[4-(4-methylphenyl)piperazin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[1-amino-3-(dimethylamino)propyl]-2-[[4-(4-methylphenyl)piperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 135144468 |
| Molecular Formula | C24H33N5 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 4-[1-amino-3-(dimethylamino)propyl]-2-[[4-(4-methylphenyl)piperazin-1-yl]methyl]benzonitrile |
| SMILES | Cc1ccc(N2CCN(Cc3cc(C(N)CCN(C)C)ccc3C#N)CC2)cc1 |
| InChI | InChI=1S/C24H33N5/c1-19-4-8-23(9-5-19)29-14-12-28(13-15-29)18-22-16-20(6-7-21(22)17-25)24(26)10-11-27(2)3/h4-9,16,24H,10-15,18,26H2,1-3H3 |
| InChIKey | VCOXVTNVNWMJDH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|