C28H37N5 — CID 135144393
2-[[4-(4-cyclopentylphenyl)piperazin-1-yl]methyl]-4-(4-methylpiperazin-1-yl)benzonitrile (PubChem CID 135144393) has the molecular formula C28H37N5 and a molecular weight of 443.64 g/mol. Its IUPAC name is 2-[[4-(4-cyclopentylphenyl)piperazin-1-yl]methyl]-4-(4-methylpiperazin-1-yl)benzonitrile.
| Compound Name | 2-[[4-(4-cyclopentylphenyl)piperazin-1-yl]methyl]-4-(4-methylpiperazin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 135144393 |
| Molecular Formula | C28H37N5 |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | 2-[[4-(4-cyclopentylphenyl)piperazin-1-yl]methyl]-4-(4-methylpiperazin-1-yl)benzonitrile |
| SMILES | CN1CCN(c2ccc(C#N)c(CN3CCN(c4ccc(C5CCCC5)cc4)CC3)c2)CC1 |
| InChI | InChI=1S/C28H37N5/c1-30-12-16-33(17-13-30)28-11-8-25(21-29)26(20-28)22-31-14-18-32(19-15-31)27-9-6-24(7-10-27)23-4-2-3-5-23/h6-11,20,23H,2-5,12-19,22H2,1H3 |
| InChIKey | IBMYLOYRWGXPLE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 36.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|