C29H36F3N5 — CID 168992554
4-[4-[4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 168992554) has the molecular formula C29H36F3N5 and a molecular weight of 511.64 g/mol. Its IUPAC name is 4-[4-[4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 168992554 |
| Molecular Formula | C29H36F3N5 |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | 4-[4-[4-[4-(piperidin-4-ylmethyl)piperazin-1-yl]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2CCC(c3ccc(N4CCN(CC5CCNCC5)CC4)cc3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C29H36F3N5/c30-29(31,32)28-19-27(6-3-25(28)20-33)36-13-9-24(10-14-36)23-1-4-26(5-2-23)37-17-15-35(16-18-37)21-22-7-11-34-12-8-22/h1-6,19,22,24,34H,7-18,21H2 |
| InChIKey | XEVSGVFOISRNER-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 45.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|