C17H20F3N3O — CID 102561547
5-[4-(oxolan-3-ylmethyl)piperazin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 102561547) has the molecular formula C17H20F3N3O and a molecular weight of 339.36 g/mol. Its IUPAC name is 5-[4-(oxolan-3-ylmethyl)piperazin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 5-[4-(oxolan-3-ylmethyl)piperazin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 102561547 |
| Molecular Formula | C17H20F3N3O |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 5-[4-(oxolan-3-ylmethyl)piperazin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(N2CCN(CC3CCOC3)CC2)ccc1C(F)(F)F |
| InChI | InChI=1S/C17H20F3N3O/c18-17(19,20)16-2-1-15(9-14(16)10-21)23-6-4-22(5-7-23)11-13-3-8-24-12-13/h1-2,9,13H,3-8,11-12H2 |
| InChIKey | GUTUNWRJNVZQAM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |