C29H40F3N3O — CID 168992761
ethane;4-[4-[4-[5-(propylamino)pentoxy]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 168992761) has the molecular formula C29H40F3N3O and a molecular weight of 503.65 g/mol. Its IUPAC name is ethane;4-[4-[4-[5-(propylamino)pentoxy]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | ethane;4-[4-[4-[5-(propylamino)pentoxy]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 168992761 |
| Molecular Formula | C29H40F3N3O |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | ethane;4-[4-[4-[5-(propylamino)pentoxy]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC.CCCNCCCCCOc1ccc(C2CCN(c3ccc(C#N)c(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C27H34F3N3O.C2H6/c1-2-14-32-15-4-3-5-18-34-25-10-7-21(8-11-25)22-12-16-33(17-13-22)24-9-6-23(20-31)26(19-24)27(28,29)30;1-2/h6-11,19,22,32H,2-5,12-18H2,1H3;1-2H3 |
| InChIKey | OWCGULJXDHWMMD-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|