C21H16F6N2O2 — CID 11517854
4-[5-[4-cyano-3-(trifluoromethyl)phenoxy]pentoxy]-2-(trifluoromethyl)benzonitrile (PubChem CID 11517854) has the molecular formula C21H16F6N2O2 and a molecular weight of 442.36 g/mol. Its IUPAC name is 4-[5-[4-cyano-3-(trifluoromethyl)phenoxy]pentoxy]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[5-[4-cyano-3-(trifluoromethyl)phenoxy]pentoxy]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 11517854 |
| Molecular Formula | C21H16F6N2O2 |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 4-[5-[4-cyano-3-(trifluoromethyl)phenoxy]pentoxy]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(OCCCCCOc2ccc(C#N)c(C(F)(F)F)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H16F6N2O2/c22-20(23,24)18-10-16(6-4-14(18)12-28)30-8-2-1-3-9-31-17-7-5-15(13-29)19(11-17)21(25,26)27/h4-7,10-11H,1-3,8-9H2 |
| InChIKey | ZAJATRPTPDFAPM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|