C13H14F3NO2 — CID 11448692
4-(4-hydroxypentoxy)-2-(trifluoromethyl)benzonitrile (PubChem CID 11448692) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is 4-(4-hydroxypentoxy)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(4-hydroxypentoxy)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 11448692 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 4-(4-hydroxypentoxy)-2-(trifluoromethyl)benzonitrile |
| SMILES | CC(O)CCCOc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F3NO2/c1-9(18)3-2-6-19-11-5-4-10(8-17)12(7-11)13(14,15)16/h4-5,7,9,18H,2-3,6H2,1H3 |
| InChIKey | KTEXGIWQRZGIBU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|