C12H9F6NO — CID 82788933
4-(4,4,4-trifluorobutoxy)-2-(trifluoromethyl)benzonitrile (PubChem CID 82788933) has the molecular formula C12H9F6NO and a molecular weight of 297.20 g/mol. Its IUPAC name is 4-(4,4,4-trifluorobutoxy)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(4,4,4-trifluorobutoxy)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 82788933 |
| Molecular Formula | C12H9F6NO |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 4-(4,4,4-trifluorobutoxy)-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(OCCCC(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C12H9F6NO/c13-11(14,15)4-1-5-20-9-3-2-8(7-19)10(6-9)12(16,17)18/h2-3,6H,1,4-5H2 |
| InChIKey | PJNVAERJPOWKHE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|