C19H12F6N2O2 — CID 11546106
4-[3-[4-cyano-3-(trifluoromethyl)phenoxy]propoxy]-2-(trifluoromethyl)benzonitrile (PubChem CID 11546106) has the molecular formula C19H12F6N2O2 and a molecular weight of 414.31 g/mol. Its IUPAC name is 4-[3-[4-cyano-3-(trifluoromethyl)phenoxy]propoxy]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[4-cyano-3-(trifluoromethyl)phenoxy]propoxy]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 11546106 |
| Molecular Formula | C19H12F6N2O2 |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 4-[3-[4-cyano-3-(trifluoromethyl)phenoxy]propoxy]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(OCCCOc2ccc(C#N)c(C(F)(F)F)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C19H12F6N2O2/c20-18(21,22)16-8-14(4-2-12(16)10-26)28-6-1-7-29-15-5-3-13(11-27)17(9-15)19(23,24)25/h2-5,8-9H,1,6-7H2 |
| InChIKey | DHHBGSNCOVXHIW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|