C18H14F3NO2 — CID 69110944
4-[4-(3-hydroxyphenyl)but-3-enoxy]-2-(trifluoromethyl)benzonitrile (PubChem CID 69110944) has the molecular formula C18H14F3NO2 and a molecular weight of 333.31 g/mol. Its IUPAC name is 4-[4-(3-hydroxyphenyl)but-3-enoxy]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-(3-hydroxyphenyl)but-3-enoxy]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 69110944 |
| Molecular Formula | C18H14F3NO2 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 4-[4-(3-hydroxyphenyl)but-3-enoxy]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(OCCC=Cc2cccc(O)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C18H14F3NO2/c19-18(20,21)17-11-16(8-7-14(17)12-22)24-9-2-1-4-13-5-3-6-15(23)10-13/h1,3-8,10-11,23H,2,9H2 |
| InChIKey | WWTIULVXLDISIG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|