C18H17F3N2O — CID 69111003
4-[4-(6-methyl-2-pyridinyl)butoxy]-2-(trifluoromethyl)benzonitrile (PubChem CID 69111003) has the molecular formula C18H17F3N2O and a molecular weight of 334.34 g/mol. Its IUPAC name is 4-[4-(6-methyl-2-pyridinyl)butoxy]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-(6-methyl-2-pyridinyl)butoxy]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 69111003 |
| Molecular Formula | C18H17F3N2O |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 4-[4-(6-methyl-2-pyridinyl)butoxy]-2-(trifluoromethyl)benzonitrile |
| SMILES | Cc1cccc(CCCCOc2ccc(C#N)c(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C18H17F3N2O/c1-13-5-4-7-15(23-13)6-2-3-10-24-16-9-8-14(12-22)17(11-16)18(19,20)21/h4-5,7-9,11H,2-3,6,10H2,1H3 |
| InChIKey | ZSGHJRUHFITELP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|