C22H18F6N2O2 — CID 11662506
4-[5-[4-cyano-3-(trifluoromethyl)phenoxy]hexoxy]-2-(trifluoromethyl)benzonitrile (PubChem CID 11662506) has the molecular formula C22H18F6N2O2 and a molecular weight of 456.39 g/mol. Its IUPAC name is 4-[5-[4-cyano-3-(trifluoromethyl)phenoxy]hexoxy]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[5-[4-cyano-3-(trifluoromethyl)phenoxy]hexoxy]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 11662506 |
| Molecular Formula | C22H18F6N2O2 |
| Molecular Weight | 456.39 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 4-[5-[4-cyano-3-(trifluoromethyl)phenoxy]hexoxy]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC(CCCCOc1ccc(C#N)c(C(F)(F)F)c1)Oc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H18F6N2O2/c1-14(32-18-8-6-16(13-30)20(11-18)22(26,27)28)4-2-3-9-31-17-7-5-15(12-29)19(10-17)21(23,24)25/h5-8,10-11,14H,2-4,9H2,1H3 |
| InChIKey | ZVXGSAHIZCQVBY-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.39 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|