C20H16F6N2O2 — CID 162581453
4-[4-[4-methanimidoyl-3-(trifluoromethyl)phenoxy]butan-2-yloxy]-2-(trifluoromethyl)benzonitrile (PubChem CID 162581453) has the molecular formula C20H16F6N2O2 and a molecular weight of 430.35 g/mol. Its IUPAC name is 4-[4-[4-methanimidoyl-3-(trifluoromethyl)phenoxy]butan-2-yloxy]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[4-methanimidoyl-3-(trifluoromethyl)phenoxy]butan-2-yloxy]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 162581453 |
| Molecular Formula | C20H16F6N2O2 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 4-[4-[4-methanimidoyl-3-(trifluoromethyl)phenoxy]butan-2-yloxy]-2-(trifluoromethyl)benzonitrile |
| SMILES | [H]/N=C/c1ccc(OCCC(C)Oc2ccc(C#N)c(C(F)(F)F)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H16F6N2O2/c1-12(30-16-5-3-14(11-28)18(9-16)20(24,25)26)6-7-29-15-4-2-13(10-27)17(8-15)19(21,22)23/h2-5,8-10,12,27H,6-7H2,1H3/b27-10+ |
| InChIKey | CFDUZWNSSKCKAK-YPXUMCKCSA-N |
| XLogP | 5.83 |
| TPSA | 66.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|