C21H20F6N2O2 — CID 162581452
[4-[2-[4-methanimidoyl-3-(trifluoromethyl)phenoxy]pentoxy]-2-(trifluoromethyl)phenyl]methanimine (PubChem CID 162581452) has the molecular formula C21H20F6N2O2 and a molecular weight of 446.39 g/mol. Its IUPAC name is [4-[2-[4-methanimidoyl-3-(trifluoromethyl)phenoxy]pentoxy]-2-(trifluoromethyl)phenyl]methanimine.
| Compound Name | [4-[2-[4-methanimidoyl-3-(trifluoromethyl)phenoxy]pentoxy]-2-(trifluoromethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 162581452 |
| Molecular Formula | C21H20F6N2O2 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | [4-[2-[4-methanimidoyl-3-(trifluoromethyl)phenoxy]pentoxy]-2-(trifluoromethyl)phenyl]methanimine |
| SMILES | [H]/N=C/c1ccc(OCC(CCC)Oc2ccc(/C=N/[H])c(C(F)(F)F)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H20F6N2O2/c1-2-3-17(31-16-7-5-14(11-29)19(9-16)21(25,26)27)12-30-15-6-4-13(10-28)18(8-15)20(22,23)24/h4-11,17,28-29H,2-3,12H2,1H3/b28-10+,29-11+ |
| InChIKey | NTYCGFZEEAPLHW-ADJYCOIBSA-N |
| XLogP | 6.35 |
| TPSA | 66.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|