C15H21F4NO — CID 102747436
2-[4-fluoro-3-(trifluoromethyl)phenoxy]-N-propylpentan-1-amine (PubChem CID 102747436) has the molecular formula C15H21F4NO and a molecular weight of 307.33 g/mol. Its IUPAC name is 2-[4-fluoro-3-(trifluoromethyl)phenoxy]-N-propylpentan-1-amine.
| Compound Name | 2-[4-fluoro-3-(trifluoromethyl)phenoxy]-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 102747436 |
| Molecular Formula | C15H21F4NO |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 2-[4-fluoro-3-(trifluoromethyl)phenoxy]-N-propylpentan-1-amine |
| SMILES | CCCNCC(CCC)Oc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H21F4NO/c1-3-5-12(10-20-8-4-2)21-11-6-7-14(16)13(9-11)15(17,18)19/h6-7,9,12,20H,3-5,8,10H2,1-2H3 |
| InChIKey | AQJUYGLDSDULRG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|