C16H23F4N — CID 107291848
1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methyl-N-propylpentan-1-amine (PubChem CID 107291848) has the molecular formula C16H23F4N and a molecular weight of 305.36 g/mol. Its IUPAC name is 1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methyl-N-propylpentan-1-amine.
| Compound Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methyl-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 107291848 |
| Molecular Formula | C16H23F4N |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methyl-N-propylpentan-1-amine |
| SMILES | CCCNC(c1ccc(F)c(C(F)(F)F)c1)C(C)CCC |
| InChI | InChI=1S/C16H23F4N/c1-4-6-11(3)15(21-9-5-2)12-7-8-14(17)13(10-12)16(18,19)20/h7-8,10-11,15,21H,4-6,9H2,1-3H3 |
| InChIKey | MIDWESVITFIMTO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |