C15H17F4N — CID 115820026
1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-propylpent-3-yn-1-amine (PubChem CID 115820026) has the molecular formula C15H17F4N and a molecular weight of 287.30 g/mol. Its IUPAC name is 1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-propylpent-3-yn-1-amine.
| Compound Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-propylpent-3-yn-1-amine |
|---|---|
| PubChem CID | 115820026 |
| Molecular Formula | C15H17F4N |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-propylpent-3-yn-1-amine |
| SMILES | CC#CCC(NCCC)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F4N/c1-3-5-6-14(20-9-4-2)11-7-8-13(16)12(10-11)15(17,18)19/h7-8,10,14,20H,4,6,9H2,1-2H3 |
| InChIKey | LNXNFTKQBJOUIN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|