C15H22F4N2 — CID 107292585
[1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-propylpentyl]hydrazine (PubChem CID 107292585) has the molecular formula C15H22F4N2 and a molecular weight of 306.35 g/mol. Its IUPAC name is [1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-propylpentyl]hydrazine.
| Compound Name | [1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-propylpentyl]hydrazine |
|---|---|
| PubChem CID | 107292585 |
| Molecular Formula | C15H22F4N2 |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | [1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-propylpentyl]hydrazine |
| SMILES | CCCC(CCC)C(NN)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H22F4N2/c1-3-5-10(6-4-2)14(21-20)11-7-8-13(16)12(9-11)15(17,18)19/h7-10,14,21H,3-6,20H2,1-2H3 |
| InChIKey | LIUDXJIFRKMYNX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|