C14H19F4NO — CID 102747632
N-[2-[4-fluoro-3-(trifluoromethyl)phenoxy]ethyl]pentan-2-amine (PubChem CID 102747632) has the molecular formula C14H19F4NO and a molecular weight of 293.30 g/mol. Its IUPAC name is N-[2-[4-fluoro-3-(trifluoromethyl)phenoxy]ethyl]pentan-2-amine.
| Compound Name | N-[2-[4-fluoro-3-(trifluoromethyl)phenoxy]ethyl]pentan-2-amine |
|---|---|
| PubChem CID | 102747632 |
| Molecular Formula | C14H19F4NO |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | N-[2-[4-fluoro-3-(trifluoromethyl)phenoxy]ethyl]pentan-2-amine |
| SMILES | CCCC(C)NCCOc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H19F4NO/c1-3-4-10(2)19-7-8-20-11-5-6-13(15)12(9-11)14(16,17)18/h5-6,9-10,19H,3-4,7-8H2,1-2H3 |
| InChIKey | ZRBNIWMWSFKBKA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|