C11H10F7NO — CID 102747534
2,2,2-trifluoro-N-[2-[4-fluoro-3-(trifluoromethyl)phenoxy]ethyl]ethanamine (PubChem CID 102747534) has the molecular formula C11H10F7NO and a molecular weight of 305.19 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[4-fluoro-3-(trifluoromethyl)phenoxy]ethyl]ethanamine.
| Compound Name | 2,2,2-trifluoro-N-[2-[4-fluoro-3-(trifluoromethyl)phenoxy]ethyl]ethanamine |
|---|---|
| PubChem CID | 102747534 |
| Molecular Formula | C11H10F7NO |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[4-fluoro-3-(trifluoromethyl)phenoxy]ethyl]ethanamine |
| SMILES | Fc1ccc(OCCNCC(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C11H10F7NO/c12-9-2-1-7(5-8(9)11(16,17)18)20-4-3-19-6-10(13,14)15/h1-2,5,19H,3-4,6H2 |
| InChIKey | FWUOBESVBWEIHD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|