C15H21F3O — CID 134265966
1-heptan-4-yl-4-methoxy-2-(trifluoromethyl)benzene (PubChem CID 134265966) has the molecular formula C15H21F3O and a molecular weight of 274.33 g/mol. Its IUPAC name is 1-heptan-4-yl-4-methoxy-2-(trifluoromethyl)benzene.
| Compound Name | 1-heptan-4-yl-4-methoxy-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 134265966 |
| Molecular Formula | C15H21F3O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 1-heptan-4-yl-4-methoxy-2-(trifluoromethyl)benzene |
| SMILES | CCCC(CCC)c1ccc(OC)cc1C(F)(F)F |
| InChI | InChI=1S/C15H21F3O/c1-4-6-11(7-5-2)13-9-8-12(19-3)10-14(13)15(16,17)18/h8-11H,4-7H2,1-3H3 |
| InChIKey | TZRNMXUAXZPGCS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |