C20H12F6N2O2 — CID 90949781
4-[3-[4-cyano-3-(trifluoromethyl)phenoxy]but-1-enoxy]-2-(trifluoromethyl)benzonitrile (PubChem CID 90949781) has the molecular formula C20H12F6N2O2 and a molecular weight of 426.32 g/mol. Its IUPAC name is 4-[3-[4-cyano-3-(trifluoromethyl)phenoxy]but-1-enoxy]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[4-cyano-3-(trifluoromethyl)phenoxy]but-1-enoxy]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 90949781 |
| Molecular Formula | C20H12F6N2O2 |
| Molecular Weight | 426.32 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 4-[3-[4-cyano-3-(trifluoromethyl)phenoxy]but-1-enoxy]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC(C=COc1ccc(C#N)c(C(F)(F)F)c1)Oc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H12F6N2O2/c1-12(30-16-5-3-14(11-28)18(9-16)20(24,25)26)6-7-29-15-4-2-13(10-27)17(8-15)19(21,22)23/h2-9,12H,1H3 |
| InChIKey | WDJUEEHLHMBOCE-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.32 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|