C16H12F3NO — CID 43320722
4-(3,4-dimethylphenoxy)-2-(trifluoromethyl)benzonitrile (PubChem CID 43320722) has the molecular formula C16H12F3NO and a molecular weight of 291.27 g/mol. Its IUPAC name is 4-(3,4-dimethylphenoxy)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(3,4-dimethylphenoxy)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 43320722 |
| Molecular Formula | C16H12F3NO |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 4-(3,4-dimethylphenoxy)-2-(trifluoromethyl)benzonitrile |
| SMILES | Cc1ccc(Oc2ccc(C#N)c(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C16H12F3NO/c1-10-3-5-13(7-11(10)2)21-14-6-4-12(9-20)15(8-14)16(17,18)19/h3-8H,1-2H3 |
| InChIKey | BDGQDGASHKZOSH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |