C19H24F3NO4 — CID 90849028
ethyl 2-[4-cyano-3-(trifluoromethyl)phenoxy]-7-methoxy-4-methylheptanoate (PubChem CID 90849028) has the molecular formula C19H24F3NO4 and a molecular weight of 387.40 g/mol. Its IUPAC name is ethyl 2-[4-cyano-3-(trifluoromethyl)phenoxy]-7-methoxy-4-methylheptanoate.
| Compound Name | ethyl 2-[4-cyano-3-(trifluoromethyl)phenoxy]-7-methoxy-4-methylheptanoate |
|---|---|
| PubChem CID | 90849028 |
| Molecular Formula | C19H24F3NO4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | ethyl 2-[4-cyano-3-(trifluoromethyl)phenoxy]-7-methoxy-4-methylheptanoate |
| SMILES | CCOC(=O)C(CC(C)CCCOC)Oc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H24F3NO4/c1-4-26-18(24)17(10-13(2)6-5-9-25-3)27-15-8-7-14(12-23)16(11-15)19(20,21)22/h7-8,11,13,17H,4-6,9-10H2,1-3H3 |
| InChIKey | BHBHHHZKAJZNHM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|