C12H12F3NOS — CID 63857734
4-(3-methoxypropylsulfanyl)-2-(trifluoromethyl)benzonitrile (PubChem CID 63857734) has the molecular formula C12H12F3NOS and a molecular weight of 275.30 g/mol. Its IUPAC name is 4-(3-methoxypropylsulfanyl)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(3-methoxypropylsulfanyl)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 63857734 |
| Molecular Formula | C12H12F3NOS |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 4-(3-methoxypropylsulfanyl)-2-(trifluoromethyl)benzonitrile |
| SMILES | COCCCSc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F3NOS/c1-17-5-2-6-18-10-4-3-9(8-16)11(7-10)12(13,14)15/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | HIBUJZHDXXJWMQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|