C42H47F3N6O4 — CID 168992779
4-[4-[4-[6-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]hexoxy]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 168992779) has the molecular formula C42H47F3N6O4 and a molecular weight of 756.87 g/mol. Its IUPAC name is 4-[4-[4-[6-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]hexoxy]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[4-[6-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]hexoxy]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 168992779 |
| Molecular Formula | C42H47F3N6O4 |
| Molecular Weight | 756.87 g/mol |
| Exact Mass | 756.36 |
| IUPAC Name | 4-[4-[4-[6-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]hexoxy]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2CCC(c3ccc(OCCCCCCN4CCN(c5ccc6c(c5)CN(C5CCC(=O)NC5=O)C6=O)CC4)cc3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C42H47F3N6O4/c43-42(44,45)37-26-34(8-5-31(37)27-46)49-18-15-30(16-19-49)29-6-10-35(11-7-29)55-24-4-2-1-3-17-48-20-22-50(23-21-48)33-9-12-36-32(25-33)28-51(41(36)54)38-13-14-39(52)47-40(38)53/h5-12,25-26,30,38H,1-4,13-24,28H2,(H,47,52,53) |
| InChIKey | XFJJIWYTLBOPRO-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.87 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|