C42H47F3N6O4 — CID 168992566
4-[(4R)-4-[4-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]butoxy]phenyl]-3,3-dimethylpiperidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 168992566) has the molecular formula C42H47F3N6O4 and a molecular weight of 756.87 g/mol. Its IUPAC name is 4-[(4R)-4-[4-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]butoxy]phenyl]-3,3-dimethylpiperidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(4R)-4-[4-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]butoxy]phenyl]-3,3-dimethylpiperidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 168992566 |
| Molecular Formula | C42H47F3N6O4 |
| Molecular Weight | 756.87 g/mol |
| Exact Mass | 756.36 |
| IUPAC Name | 4-[(4R)-4-[4-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]butoxy]phenyl]-3,3-dimethylpiperidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1(C)CN(c2ccc(C#N)c(C(F)(F)F)c2)CC[C@@H]1c1ccc(OCCCCN2CCN(c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2)cc1 |
| InChI | InChI=1S/C42H47F3N6O4/c1-41(2)27-50(32-8-5-29(25-46)36(24-32)42(43,44)45)17-15-35(41)28-6-10-33(11-7-28)55-22-4-3-16-48-18-20-49(21-19-48)31-9-12-34-30(23-31)26-51(40(34)54)37-13-14-38(52)47-39(37)53/h5-12,23-24,35,37H,3-4,13-22,26-27H2,1-2H3,(H,47,52,53)/t35-,37?/m1/s1 |
| InChIKey | SFGJARAHPLWPDM-BNWGQQNKSA-N |
| XLogP | 6.34 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.87 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|