C25H30N2O2 — CID 168992677
2-cyclopropyl-4-[4-[4-(4-hydroxybutoxy)phenyl]piperidin-1-yl]benzonitrile (PubChem CID 168992677) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 2-cyclopropyl-4-[4-[4-(4-hydroxybutoxy)phenyl]piperidin-1-yl]benzonitrile.
| Compound Name | 2-cyclopropyl-4-[4-[4-(4-hydroxybutoxy)phenyl]piperidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 168992677 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 2-cyclopropyl-4-[4-[4-(4-hydroxybutoxy)phenyl]piperidin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCC(c3ccc(OCCCCO)cc3)CC2)cc1C1CC1 |
| InChI | InChI=1S/C25H30N2O2/c26-18-22-5-8-23(17-25(22)21-3-4-21)27-13-11-20(12-14-27)19-6-9-24(10-7-19)29-16-2-1-15-28/h5-10,17,20-21,28H,1-4,11-16H2 |
| InChIKey | TXEIPQFAHLTDKT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|