C15H21FN4 — CID 63265350
3-fluoro-4-[[methyl(2-piperazin-1-ylethyl)amino]methyl]benzonitrile (PubChem CID 63265350) has the molecular formula C15H21FN4 and a molecular weight of 276.36 g/mol. Its IUPAC name is 3-fluoro-4-[[methyl(2-piperazin-1-ylethyl)amino]methyl]benzonitrile.
| Compound Name | 3-fluoro-4-[[methyl(2-piperazin-1-ylethyl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 63265350 |
| Molecular Formula | C15H21FN4 |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 3-fluoro-4-[[methyl(2-piperazin-1-ylethyl)amino]methyl]benzonitrile |
| SMILES | CN(CCN1CCNCC1)Cc1ccc(C#N)cc1F |
| InChI | InChI=1S/C15H21FN4/c1-19(8-9-20-6-4-18-5-7-20)12-14-3-2-13(11-17)10-15(14)16/h2-3,10,18H,4-9,12H2,1H3 |
| InChIKey | RFZPIKDHUYURHQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 42.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |