C11H14FN3 — CID 62685924
4-[[2-aminoethyl(methyl)amino]methyl]-3-fluorobenzonitrile (PubChem CID 62685924) has the molecular formula C11H14FN3 and a molecular weight of 207.25 g/mol. Its IUPAC name is 4-[[2-aminoethyl(methyl)amino]methyl]-3-fluorobenzonitrile.
| Compound Name | 4-[[2-aminoethyl(methyl)amino]methyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 62685924 |
| Molecular Formula | C11H14FN3 |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 4-[[2-aminoethyl(methyl)amino]methyl]-3-fluorobenzonitrile |
| SMILES | CN(CCN)Cc1ccc(C#N)cc1F |
| InChI | InChI=1S/C11H14FN3/c1-15(5-4-13)8-10-3-2-9(7-14)6-11(10)12/h2-3,6H,4-5,8,13H2,1H3 |
| InChIKey | YNIWAXNMQNFJNV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |