C15H23FN4O — CID 63265639
4-fluoro-3-[[methyl(2-piperazin-1-ylethyl)amino]methyl]benzamide (PubChem CID 63265639) has the molecular formula C15H23FN4O and a molecular weight of 294.37 g/mol. Its IUPAC name is 4-fluoro-3-[[methyl(2-piperazin-1-ylethyl)amino]methyl]benzamide.
| Compound Name | 4-fluoro-3-[[methyl(2-piperazin-1-ylethyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 63265639 |
| Molecular Formula | C15H23FN4O |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 4-fluoro-3-[[methyl(2-piperazin-1-ylethyl)amino]methyl]benzamide |
| SMILES | CN(CCN1CCNCC1)Cc1cc(C(N)=O)ccc1F |
| InChI | InChI=1S/C15H23FN4O/c1-19(8-9-20-6-4-18-5-7-20)11-13-10-12(15(17)21)2-3-14(13)16/h2-3,10,18H,4-9,11H2,1H3,(H2,17,21) |
| InChIKey | ZQKGKCWZUPLPEV-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |