C13H31N3O2 — CID 70236952
ethanol;1-(3-methoxybutyl)-1,4,7-triazonane (PubChem CID 70236952) has the molecular formula C13H31N3O2 and a molecular weight of 261.41 g/mol. Its IUPAC name is ethanol;1-(3-methoxybutyl)-1,4,7-triazonane.
| Compound Name | ethanol;1-(3-methoxybutyl)-1,4,7-triazonane |
|---|---|
| PubChem CID | 70236952 |
| Molecular Formula | C13H31N3O2 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.24 |
| IUPAC Name | ethanol;1-(3-methoxybutyl)-1,4,7-triazonane |
| SMILES | CCO.COC(C)CCN1CCNCCNCC1 |
| InChI | InChI=1S/C11H25N3O.C2H6O/c1-11(15-2)3-8-14-9-6-12-4-5-13-7-10-14;1-2-3/h11-13H,3-10H2,1-2H3;3H,2H2,1H3 |
| InChIKey | LQRIKCJDEUMIIQ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |