C11H20Cl3NO2 — CID 2302557
N-[(1S)-1-butoxy-2,2,2-trichloroethyl]-3-methylbutanamide (PubChem CID 2302557) has the molecular formula C11H20Cl3NO2 and a molecular weight of 304.65 g/mol. Its IUPAC name is N-[(1S)-1-butoxy-2,2,2-trichloroethyl]-3-methylbutanamide.
| Compound Name | N-[(1S)-1-butoxy-2,2,2-trichloroethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 2302557 |
| Molecular Formula | C11H20Cl3NO2 |
| Molecular Weight | 304.65 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | N-[(1S)-1-butoxy-2,2,2-trichloroethyl]-3-methylbutanamide |
| SMILES | CCCCO[C@H](NC(=O)CC(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H20Cl3NO2/c1-4-5-6-17-10(11(12,13)14)15-9(16)7-8(2)3/h8,10H,4-7H2,1-3H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | BPPSYXWWTMBMAX-JTQLQIEISA-N |
| XLogP | 3.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.65 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|