C12H13Cl4NO3 — CID 13390571
2-hydroxy-N-[2,2,2-trichloro-1-(3-chloropropoxy)ethyl]benzamide (PubChem CID 13390571) has the molecular formula C12H13Cl4NO3 and a molecular weight of 361.05 g/mol. Its IUPAC name is 2-hydroxy-N-[2,2,2-trichloro-1-(3-chloropropoxy)ethyl]benzamide.
| Compound Name | 2-hydroxy-N-[2,2,2-trichloro-1-(3-chloropropoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 13390571 |
| Molecular Formula | C12H13Cl4NO3 |
| Molecular Weight | 361.05 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 2-hydroxy-N-[2,2,2-trichloro-1-(3-chloropropoxy)ethyl]benzamide |
| SMILES | O=C(NC(OCCCCl)C(Cl)(Cl)Cl)c1ccccc1O |
| InChI | InChI=1S/C12H13Cl4NO3/c13-6-3-7-20-11(12(14,15)16)17-10(19)8-4-1-2-5-9(8)18/h1-2,4-5,11,18H,3,6-7H2,(H,17,19) |
| InChIKey | SFQBNVDEXBXFMK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.05 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|