C24H47NO5Si — CID 11662531
(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-(3-methylbut-2-enyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid (PubChem CID 11662531) has the molecular formula C24H47NO5Si and a molecular weight of 457.73 g/mol. Its IUPAC name is (2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-(3-methylbut-2-enyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid.
| Compound Name | (2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-(3-methylbut-2-enyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid |
|---|---|
| PubChem CID | 11662531 |
| Molecular Formula | C24H47NO5Si |
| Molecular Weight | 457.73 g/mol |
| Exact Mass | 457.32 |
| IUPAC Name | (2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-(3-methylbut-2-enyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid |
| SMILES | CC(C)=CC[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](NC(=O)OC(C)(C)C)C(C)C)C(=O)O |
| InChI | InChI=1S/C24H47NO5Si/c1-16(2)13-14-18(21(26)27)15-19(30-31(11,12)24(8,9)10)20(17(3)4)25-22(28)29-23(5,6)7/h13,17-20H,14-15H2,1-12H3,(H,25,28)(H,26,27)/t18-,19+,20+/m1/s1 |
| InChIKey | AOZFBNWGXZFXME-AABGKKOBSA-N |
| XLogP | 6.37 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.73 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|