C20H40O6Si — CID 101232396
4-[(4R,5S)-5-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)propyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-one (PubChem CID 101232396) has the molecular formula C20H40O6Si and a molecular weight of 404.62 g/mol. Its IUPAC name is 4-[(4R,5S)-5-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)propyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-one.
| Compound Name | 4-[(4R,5S)-5-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)propyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-one |
|---|---|
| PubChem CID | 101232396 |
| Molecular Formula | C20H40O6Si |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 4-[(4R,5S)-5-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)propyl]-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-one |
| SMILES | COCO[C@H](CO[Si](C)(C)C(C)(C)C)C[C@@H]1OC(C)(C)O[C@@H]1CCC(C)=O |
| InChI | InChI=1S/C20H40O6Si/c1-15(21)10-11-17-18(26-20(5,6)25-17)12-16(23-14-22-7)13-24-27(8,9)19(2,3)4/h16-18H,10-14H2,1-9H3/t16-,17+,18-/m0/s1 |
| InChIKey | HIJLFUSJDQRDJG-KSZLIROESA-N |
| XLogP | 4.28 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|