C15H29NO5 — CID 101150229
methyl (2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-methoxy-5,5-dimethyloxane-2-carboximidate (PubChem CID 101150229) has the molecular formula C15H29NO5 and a molecular weight of 303.40 g/mol. Its IUPAC name is methyl (2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-methoxy-5,5-dimethyloxane-2-carboximidate.
| Compound Name | methyl (2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-methoxy-5,5-dimethyloxane-2-carboximidate |
|---|---|
| PubChem CID | 101150229 |
| Molecular Formula | C15H29NO5 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | methyl (2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-methoxy-5,5-dimethyloxane-2-carboximidate |
| SMILES | [H]/N=C(\OC)[C@@H]1C[C@@H](OC)C(C)(C)[C@@H](C[C@@H](COC)OC)O1 |
| InChI | InChI=1S/C15H29NO5/c1-15(2)12(19-5)8-11(14(16)20-6)21-13(15)7-10(18-4)9-17-3/h10-13,16H,7-9H2,1-6H3/b16-14-/t10-,11-,12+,13+/m0/s1 |
| InChIKey | CRVBJMLVAJQJGQ-NGCLZFNLSA-N |
| XLogP | 1.86 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|