C15H27N3O6 — CID 11100041
(4aS,6R,8S,8aR)-4-azido-6-[(2R)-2,3-dimethoxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine (PubChem CID 11100041) has the molecular formula C15H27N3O6 and a molecular weight of 345.40 g/mol. Its IUPAC name is (4aS,6R,8S,8aR)-4-azido-6-[(2R)-2,3-dimethoxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aS,6R,8S,8aR)-4-azido-6-[(2R)-2,3-dimethoxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 11100041 |
| Molecular Formula | C15H27N3O6 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (4aS,6R,8S,8aR)-4-azido-6-[(2R)-2,3-dimethoxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine |
| SMILES | COC[C@@H](C[C@H]1O[C@@H]2C(N=[N+]=[N-])OCO[C@@H]2[C@@H](OC)C1(C)C)OC |
| InChI | InChI=1S/C15H27N3O6/c1-15(2)10(6-9(20-4)7-19-3)24-12-11(13(15)21-5)22-8-23-14(12)17-18-16/h9-14H,6-8H2,1-5H3/t9-,10-,11+,12+,13-,14?/m1/s1 |
| InChIKey | AVBLYHSBYFDVOX-UDRYYEOVSA-N |
| XLogP | 1.86 |
| TPSA | 104.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|